C10H16F3NO3 — CID 22829270
ethyl (1Z)-N-ethoxycarbonyl-5,5,5-trifluoropentanimidate (PubChem CID 22829270) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is ethyl (1Z)-N-ethoxycarbonyl-5,5,5-trifluoropentanimidate.
| Compound Name | ethyl (1Z)-N-ethoxycarbonyl-5,5,5-trifluoropentanimidate |
|---|---|
| PubChem CID | 22829270 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | ethyl (1Z)-N-ethoxycarbonyl-5,5,5-trifluoropentanimidate |
| SMILES | CCOC(=O)/N=C(/CCCC(F)(F)F)OCC |
| InChI | InChI=1S/C10H16F3NO3/c1-3-16-8(14-9(15)17-4-2)6-5-7-10(11,12)13/h3-7H2,1-2H3/b14-8- |
| InChIKey | YHJOINIUONZCKR-ZSOIEALJSA-N |
| XLogP | 3.31 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|