About 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride
2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride (PubChem CID 131858012) has the molecular formula C14H30Cl2N2O2
and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride |
| PubChem CID | 131858012 |
| Molecular Formula | C14H30Cl2N2O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride |
| SMILES | CCN(CC)CCOC(=O)CCC1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H28N2O2.2ClH/c1-3-16(4-2)11-12-18-14(17)6-5-13-7-9-15-10-8-13;;/h13,15H,3-12H2,1-2H3;2*1H |
| InChIKey | ACYNESKSFPXNEB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride (CID 131858012) is 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride is CCN(CC)CCOC(=O)CCC1CCNCC1.Cl.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride?
The InChIKey is ACYNESKSFPXNEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2.2ClH/c1-3-16(4-2)11-12-18-14(17)6-5-13-7-9-15-10-8-13;;/h13,15H,3-12H2,1-2H3;2*1H.
What are the key properties of 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride?
2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride has a molecular weight of 329.31 g/mol, XLogP of 2.49, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3-piperidin-4-ylpropanoate;dihydrochloride is sourced from PubChem (CID 131858012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).