About propanoyl 3-piperidin-4-ylpropanoate;hydrochloride
propanoyl 3-piperidin-4-ylpropanoate;hydrochloride (PubChem CID 174378538) has the molecular formula C11H20ClNO3
and a molecular weight of 249.74 g/mol. Its IUPAC name is propanoyl 3-piperidin-4-ylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | propanoyl 3-piperidin-4-ylpropanoate;hydrochloride |
| PubChem CID | 174378538 |
| Molecular Formula | C11H20ClNO3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | propanoyl 3-piperidin-4-ylpropanoate;hydrochloride |
| SMILES | CCC(=O)OC(=O)CCC1CCNCC1.Cl |
| InChI | InChI=1S/C11H19NO3.ClH/c1-2-10(13)15-11(14)4-3-9-5-7-12-8-6-9;/h9,12H,2-8H2,1H3;1H |
| InChIKey | RXYTVKIXIGAVGL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyl 3-piperidin-4-ylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl 3-piperidin-4-ylpropanoate;hydrochloride?
The IUPAC name of propanoyl 3-piperidin-4-ylpropanoate;hydrochloride (CID 174378538) is propanoyl 3-piperidin-4-ylpropanoate;hydrochloride.
What is the SMILES notation for propanoyl 3-piperidin-4-ylpropanoate;hydrochloride?
The canonical SMILES for propanoyl 3-piperidin-4-ylpropanoate;hydrochloride is CCC(=O)OC(=O)CCC1CCNCC1.Cl.
What is the InChIKey of propanoyl 3-piperidin-4-ylpropanoate;hydrochloride?
The InChIKey is RXYTVKIXIGAVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3.ClH/c1-2-10(13)15-11(14)4-3-9-5-7-12-8-6-9;/h9,12H,2-8H2,1H3;1H.
What are the key properties of propanoyl 3-piperidin-4-ylpropanoate;hydrochloride?
propanoyl 3-piperidin-4-ylpropanoate;hydrochloride has a molecular weight of 249.74 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl 3-piperidin-4-ylpropanoate;hydrochloride is sourced from PubChem (CID 174378538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).