C26H18N2S2 — CID 131858418
(Z)-2,3-bis(naphthalen-1-ylmethylsulfanyl)but-2-enedinitrile (PubChem CID 131858418) has the molecular formula C26H18N2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is (Z)-2,3-bis(naphthalen-1-ylmethylsulfanyl)but-2-enedinitrile.
| Compound Name | (Z)-2,3-bis(naphthalen-1-ylmethylsulfanyl)but-2-enedinitrile |
|---|---|
| PubChem CID | 131858418 |
| Molecular Formula | C26H18N2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (Z)-2,3-bis(naphthalen-1-ylmethylsulfanyl)but-2-enedinitrile |
| SMILES | N#C/C(SCc1cccc2ccccc12)=C(\C#N)SCc1cccc2ccccc12 |
| InChI | InChI=1S/C26H18N2S2/c27-15-25(29-17-21-11-5-9-19-7-1-3-13-23(19)21)26(16-28)30-18-22-12-6-10-20-8-2-4-14-24(20)22/h1-14H,17-18H2/b26-25- |
| InChIKey | LFBTVRMOVCEIOI-QPLCGJKRSA-N |
| XLogP | 7.42 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|