C10H14ClN2O6P — CID 131858451
(2-chloro-4-nitrophenyl) 2-(ethylamino)ethyl hydrogen phosphate (PubChem CID 131858451) has the molecular formula C10H14ClN2O6P and a molecular weight of 324.66 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 2-(ethylamino)ethyl hydrogen phosphate.
| Compound Name | (2-chloro-4-nitrophenyl) 2-(ethylamino)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 131858451 |
| Molecular Formula | C10H14ClN2O6P |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 2-(ethylamino)ethyl hydrogen phosphate |
| SMILES | CCNCCOP(=O)(O)Oc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H14ClN2O6P/c1-2-12-5-6-18-20(16,17)19-10-4-3-8(13(14)15)7-9(10)11/h3-4,7,12H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | XTVMTYZHYRDEMZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|