About (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate
(2-chloro-4-nitrophenyl) phenyl hydrogen phosphate (PubChem CID 141057225) has the molecular formula C12H9ClNO6P
and a molecular weight of 329.63 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate.
Molecular Properties
| Compound Name | (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate |
| PubChem CID | 141057225 |
| Molecular Formula | C12H9ClNO6P |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(O)Oc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C12H9ClNO6P/c13-11-8-9(14(15)16)6-7-12(11)20-21(17,18)19-10-4-2-1-3-5-10/h1-8H,(H,17,18) |
| InChIKey | MHJVRNYNWNWJGI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate?
The IUPAC name of (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate (CID 141057225) is (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate.
What is the SMILES notation for (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate?
The canonical SMILES for (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate is O=[N+]([O-])c1ccc(OP(=O)(O)Oc2ccccc2)c(Cl)c1.
What is the InChIKey of (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate?
The InChIKey is MHJVRNYNWNWJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClNO6P/c13-11-8-9(14(15)16)6-7-12(11)20-21(17,18)19-10-4-2-1-3-5-10/h1-8H,(H,17,18).
What are the key properties of (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate?
(2-chloro-4-nitrophenyl) phenyl hydrogen phosphate has a molecular weight of 329.63 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-nitrophenyl) phenyl hydrogen phosphate is sourced from PubChem (CID 141057225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).