C8H10N2O3S — CID 131859367
[(4-methylphenyl)methylideneamino]sulfamic acid (PubChem CID 131859367) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is [(4-methylphenyl)methylideneamino]sulfamic acid.
| Compound Name | [(4-methylphenyl)methylideneamino]sulfamic acid |
|---|---|
| PubChem CID | 131859367 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | [(4-methylphenyl)methylideneamino]sulfamic acid |
| SMILES | Cc1ccc(C=NNS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H10N2O3S/c1-7-2-4-8(5-3-7)6-9-10-14(11,12)13/h2-6,10H,1H3,(H,11,12,13) |
| InChIKey | JJUPOYCAYJNYHR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|