C9H12N2O3S — CID 45098057
[(Z)-1-(4-methylphenyl)ethylideneamino]sulfamic acid (PubChem CID 45098057) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is [(Z)-1-(4-methylphenyl)ethylideneamino]sulfamic acid.
| Compound Name | [(Z)-1-(4-methylphenyl)ethylideneamino]sulfamic acid |
|---|---|
| PubChem CID | 45098057 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [(Z)-1-(4-methylphenyl)ethylideneamino]sulfamic acid |
| SMILES | C/C(=N/NS(=O)(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H12N2O3S/c1-7-3-5-9(6-4-7)8(2)10-11-15(12,13)14/h3-6,11H,1-2H3,(H,12,13,14)/b10-8- |
| InChIKey | ZTODTZMKSBLZEP-NTMALXAHSA-N |
| XLogP | 1.11 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|