C22H28N4 — CID 166987269
2-methyl-1-N,1-N'-bis[(E)-1-(4-methylphenyl)ethylideneamino]prop-1-ene-1,1-diamine (PubChem CID 166987269) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-methyl-1-N,1-N'-bis[(E)-1-(4-methylphenyl)ethylideneamino]prop-1-ene-1,1-diamine.
| Compound Name | 2-methyl-1-N,1-N'-bis[(E)-1-(4-methylphenyl)ethylideneamino]prop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 166987269 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-methyl-1-N,1-N'-bis[(E)-1-(4-methylphenyl)ethylideneamino]prop-1-ene-1,1-diamine |
| SMILES | CC(C)=C(N/N=C(\C)c1ccc(C)cc1)N/N=C(\C)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28N4/c1-15(2)22(25-23-18(5)20-11-7-16(3)8-12-20)26-24-19(6)21-13-9-17(4)10-14-21/h7-14,25-26H,1-6H3/b23-18+,24-19+ |
| InChIKey | VXKKJLYPKXRSKC-KBQFLUNPSA-N |
| XLogP | 4.88 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|