C8H14Ge — CID 131859531
1-methyl-1-prop-2-enyl-2,5-dihydrogermole (PubChem CID 131859531) has the molecular formula C8H14Ge and a molecular weight of 182.81 g/mol. Its IUPAC name is 1-methyl-1-prop-2-enyl-2,5-dihydrogermole.
| Compound Name | 1-methyl-1-prop-2-enyl-2,5-dihydrogermole |
|---|---|
| PubChem CID | 131859531 |
| Molecular Formula | C8H14Ge |
| Molecular Weight | 182.81 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 1-methyl-1-prop-2-enyl-2,5-dihydrogermole |
| SMILES | C=CC[Ge]1(C)CC=CC1 |
| InChI | InChI=1S/C8H14Ge/c1-3-6-9(2)7-4-5-8-9/h3-5H,1,6-8H2,2H3 |
| InChIKey | SBWVLBUUXRDOGA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.81 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|