C10H15NO4 — CID 131859571
methyl (1R,5S,6R)-9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6-carboxylate (PubChem CID 131859571) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is methyl (1R,5S,6R)-9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6-carboxylate.
| Compound Name | methyl (1R,5S,6R)-9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6-carboxylate |
|---|---|
| PubChem CID | 131859571 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | methyl (1R,5S,6R)-9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C[C@@H]2COC[C@H]1N2C |
| InChI | InChI=1S/C10H15NO4/c1-11-6-3-8(12)9(10(13)14-2)7(11)5-15-4-6/h6-7,9H,3-5H2,1-2H3/t6-,7-,9-/m1/s1 |
| InChIKey | LMHIKCQWTLNFEP-ZXFLCMHBSA-N |
| XLogP | -0.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|