C14H21NO6 — CID 536042
diethyl 9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,8-dicarboxylate (PubChem CID 536042) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is diethyl 9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,8-dicarboxylate.
| Compound Name | diethyl 9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,8-dicarboxylate |
|---|---|
| PubChem CID | 536042 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | diethyl 9-methyl-7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)C(C(=O)OCC)C2COCC1N2C |
| InChI | InChI=1S/C14H21NO6/c1-4-20-13(17)10-8-6-19-7-9(15(8)3)11(12(10)16)14(18)21-5-2/h8-11H,4-7H2,1-3H3 |
| InChIKey | CJWVGNPAIVDIHV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|