C14H23NO5 — CID 95386977
diethyl (2R,3S,5S,6R)-1,2,6-trimethyl-4-oxopiperidine-3,5-dicarboxylate (PubChem CID 95386977) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is diethyl (2R,3S,5S,6R)-1,2,6-trimethyl-4-oxopiperidine-3,5-dicarboxylate.
| Compound Name | diethyl (2R,3S,5S,6R)-1,2,6-trimethyl-4-oxopiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 95386977 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | diethyl (2R,3S,5S,6R)-1,2,6-trimethyl-4-oxopiperidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)[C@@H](C(=O)OCC)[C@@H](C)N(C)[C@@H]1C |
| InChI | InChI=1S/C14H23NO5/c1-6-19-13(17)10-8(3)15(5)9(4)11(12(10)16)14(18)20-7-2/h8-11H,6-7H2,1-5H3/t8-,9-,10+,11+/m1/s1 |
| InChIKey | LAYGCYSGPGGRFL-ZNSHCXBVSA-N |
| XLogP | 0.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|