7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid

C9H11NO6 — CID 142795835

IUPAC7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid
SMILESO=C(O)C1C(=O)CC2COCC1N2C(=O)O
InChIInChI=1S/C9H11NO6/c11-6-1-4-2-16-3-5(7(6)8(12)13)10(4)9(14)15/h4-5,7H,1-3H2,(H,12,13)(H,14,15)
InChIKeyRZHWDIRBMUIJAQ-UHFFFAOYSA-N
MW229.19 g/mol
LogP-0.59
Rot. Bonds1

About 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid

7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid (PubChem CID 142795835) has the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. Its IUPAC name is 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid.

Molecular Properties

Compound Name7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid
PubChem CID142795835
Molecular FormulaC9H11NO6
Molecular Weight229.19 g/mol
Exact Mass229.06
IUPAC Name7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid
SMILESO=C(O)C1C(=O)CC2COCC1N2C(=O)O
InChIInChI=1S/C9H11NO6/c11-6-1-4-2-16-3-5(7(6)8(12)13)10(4)9(14)15/h4-5,7H,1-3H2,(H,12,13)(H,14,15)
InChIKeyRZHWDIRBMUIJAQ-UHFFFAOYSA-N
XLogP-0.59
TPSA104.14 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.19
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid?
The IUPAC name of 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid (CID 142795835) is 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid.
What is the SMILES notation for 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid?
The canonical SMILES for 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid is O=C(O)C1C(=O)CC2COCC1N2C(=O)O.
What is the InChIKey of 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid?
The InChIKey is RZHWDIRBMUIJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO6/c11-6-1-4-2-16-3-5(7(6)8(12)13)10(4)9(14)15/h4-5,7H,1-3H2,(H,12,13)(H,14,15).
What are the key properties of 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid?
7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid has a molecular weight of 229.19 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-3-oxa-9-azabicyclo[3.3.1]nonane-6,9-dicarboxylic acid is sourced from PubChem (CID 142795835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).