C6H10O5 — CID 131863261
1-(3,4,5-trihydroxyoxolan-2-yl)ethanone (PubChem CID 131863261) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is 1-(3,4,5-trihydroxyoxolan-2-yl)ethanone.
| Compound Name | 1-(3,4,5-trihydroxyoxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 131863261 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 1-(3,4,5-trihydroxyoxolan-2-yl)ethanone |
| SMILES | CC(=O)C1OC(O)C(O)C1O |
| InChI | InChI=1S/C6H10O5/c1-2(7)5-3(8)4(9)6(10)11-5/h3-6,8-10H,1H3 |
| InChIKey | VTYZWSTWPSLGHX-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |