C12H15FN2O4 — CID 131864632
4-ethyl-2-(3-fluoro-4-nitrophenyl)morpholin-2-ol (PubChem CID 131864632) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-ethyl-2-(3-fluoro-4-nitrophenyl)morpholin-2-ol.
| Compound Name | 4-ethyl-2-(3-fluoro-4-nitrophenyl)morpholin-2-ol |
|---|---|
| PubChem CID | 131864632 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-ethyl-2-(3-fluoro-4-nitrophenyl)morpholin-2-ol |
| SMILES | CCN1CCOC(O)(c2ccc([N+](=O)[O-])c(F)c2)C1 |
| InChI | InChI=1S/C12H15FN2O4/c1-2-14-5-6-19-12(16,8-14)9-3-4-11(15(17)18)10(13)7-9/h3-4,7,16H,2,5-6,8H2,1H3 |
| InChIKey | QBBZDYSMXKIZMA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|