C17H18BrF2N5O2 — CID 89494334
6-bromo-N-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]-3-nitropyridin-2-amine (PubChem CID 89494334) has the molecular formula C17H18BrF2N5O2 and a molecular weight of 442.26 g/mol. Its IUPAC name is 6-bromo-N-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]-3-nitropyridin-2-amine.
| Compound Name | 6-bromo-N-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 89494334 |
| Molecular Formula | C17H18BrF2N5O2 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 6-bromo-N-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]-3-nitropyridin-2-amine |
| SMILES | CCN1CCN(c2c(F)cc(Nc3nc(Br)ccc3[N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C17H18BrF2N5O2/c1-2-23-5-7-24(8-6-23)16-12(19)9-11(10-13(16)20)21-17-14(25(26)27)3-4-15(18)22-17/h3-4,9-10H,2,5-8H2,1H3,(H,21,22) |
| InChIKey | HIHBVQOWVUHHPJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|