C16H16ClFN4O2 — CID 88545924
6-chloro-N-(3-fluoro-4-piperidin-1-ylphenyl)-3-nitropyridin-2-amine (PubChem CID 88545924) has the molecular formula C16H16ClFN4O2 and a molecular weight of 350.78 g/mol. Its IUPAC name is 6-chloro-N-(3-fluoro-4-piperidin-1-ylphenyl)-3-nitropyridin-2-amine.
| Compound Name | 6-chloro-N-(3-fluoro-4-piperidin-1-ylphenyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 88545924 |
| Molecular Formula | C16H16ClFN4O2 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 6-chloro-N-(3-fluoro-4-piperidin-1-ylphenyl)-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1Nc1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C16H16ClFN4O2/c17-15-7-6-14(22(23)24)16(20-15)19-11-4-5-13(12(18)10-11)21-8-2-1-3-9-21/h4-7,10H,1-3,8-9H2,(H,19,20) |
| InChIKey | CSZGFWFTBHMLEH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|