C20H26FN5O3 — CID 67995001
1-[4-[[6-(tert-butylamino)-3-nitro-2-pyridinyl]amino]-2-fluorophenyl]piperidin-4-ol (PubChem CID 67995001) has the molecular formula C20H26FN5O3 and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[4-[[6-(tert-butylamino)-3-nitro-2-pyridinyl]amino]-2-fluorophenyl]piperidin-4-ol.
| Compound Name | 1-[4-[[6-(tert-butylamino)-3-nitro-2-pyridinyl]amino]-2-fluorophenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 67995001 |
| Molecular Formula | C20H26FN5O3 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[4-[[6-(tert-butylamino)-3-nitro-2-pyridinyl]amino]-2-fluorophenyl]piperidin-4-ol |
| SMILES | CC(C)(C)Nc1ccc([N+](=O)[O-])c(Nc2ccc(N3CCC(O)CC3)c(F)c2)n1 |
| InChI | InChI=1S/C20H26FN5O3/c1-20(2,3)24-18-7-6-17(26(28)29)19(23-18)22-13-4-5-16(15(21)12-13)25-10-8-14(27)9-11-25/h4-7,12,14,27H,8-11H2,1-3H3,(H2,22,23,24) |
| InChIKey | GZURBYITEFQXDO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|