C20H23FN6O3 — CID 67994687
1-[2-fluoro-4-[[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]amino]phenyl]piperidin-4-ol (PubChem CID 67994687) has the molecular formula C20H23FN6O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is 1-[2-fluoro-4-[[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]amino]phenyl]piperidin-4-ol.
| Compound Name | 1-[2-fluoro-4-[[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]amino]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 67994687 |
| Molecular Formula | C20H23FN6O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[2-fluoro-4-[[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]amino]phenyl]piperidin-4-ol |
| SMILES | CC1=NCCN1c1ccc([N+](=O)[O-])c(Nc2ccc(N3CCC(O)CC3)c(F)c2)n1 |
| InChI | InChI=1S/C20H23FN6O3/c1-13-22-8-11-26(13)19-5-4-18(27(29)30)20(24-19)23-14-2-3-17(16(21)12-14)25-9-6-15(28)7-10-25/h2-5,12,15,28H,6-11H2,1H3,(H,23,24) |
| InChIKey | NOURZGGLDAUTRW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|