C21H26FN5O3 — CID 67994696
1-[6-[2-(3-fluoropiperidin-1-yl)anilino]-5-nitro-2-pyridinyl]piperidin-4-ol (PubChem CID 67994696) has the molecular formula C21H26FN5O3 and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-[6-[2-(3-fluoropiperidin-1-yl)anilino]-5-nitro-2-pyridinyl]piperidin-4-ol.
| Compound Name | 1-[6-[2-(3-fluoropiperidin-1-yl)anilino]-5-nitro-2-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 67994696 |
| Molecular Formula | C21H26FN5O3 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-[6-[2-(3-fluoropiperidin-1-yl)anilino]-5-nitro-2-pyridinyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(O)CC2)nc1Nc1ccccc1N1CCCC(F)C1 |
| InChI | InChI=1S/C21H26FN5O3/c22-15-4-3-11-26(14-15)18-6-2-1-5-17(18)23-21-19(27(29)30)7-8-20(24-21)25-12-9-16(28)10-13-25/h1-2,5-8,15-16,28H,3-4,9-14H2,(H,23,24) |
| InChIKey | JIGGAGFPUQWUAN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 94.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|