C15H15BrFN5O2 — CID 89494293
6-bromo-N-(3-fluoro-4-piperazin-1-ylphenyl)-3-nitropyridin-2-amine (PubChem CID 89494293) has the molecular formula C15H15BrFN5O2 and a molecular weight of 396.22 g/mol. Its IUPAC name is 6-bromo-N-(3-fluoro-4-piperazin-1-ylphenyl)-3-nitropyridin-2-amine.
| Compound Name | 6-bromo-N-(3-fluoro-4-piperazin-1-ylphenyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 89494293 |
| Molecular Formula | C15H15BrFN5O2 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 6-bromo-N-(3-fluoro-4-piperazin-1-ylphenyl)-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Br)nc1Nc1ccc(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C15H15BrFN5O2/c16-14-4-3-13(22(23)24)15(20-14)19-10-1-2-12(11(17)9-10)21-7-5-18-6-8-21/h1-4,9,18H,5-8H2,(H,19,20) |
| InChIKey | RBKPQZOSKXLIRF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|