C11H18N2NaO3 — CID 131864768
CID 131864768 (PubChem CID 131864768) has the molecular formula C11H18N2NaO3 and a molecular weight of 249.27 g/mol.
| Compound Name | CID 131864768 |
|---|---|
| PubChem CID | 131864768 |
| Molecular Formula | C11H18N2NaO3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | — |
| SMILES | CC[C@@H](C(=O)O)[C@H](CO)Cc1cncn1C.[Na] |
| InChI | InChI=1S/C11H18N2O3.Na/c1-3-10(11(15)16)8(6-14)4-9-5-12-7-13(9)2;/h5,7-8,10,14H,3-4,6H2,1-2H3,(H,15,16);/t8-,10+;/m0./s1 |
| InChIKey | HYQGSWXNDDMWSO-KXNXZCPBSA-N |
| XLogP | 0.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |