C17H12F3NO2 — CID 131866937
[3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]methanol (PubChem CID 131866937) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is [3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]methanol.
| Compound Name | [3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131866937 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1c(-c2ccccc2)noc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F3NO2/c18-17(19,20)13-8-6-12(7-9-13)16-14(10-22)15(21-23-16)11-4-2-1-3-5-11/h1-9,22H,10H2 |
| InChIKey | BVDCJZZKJFKFKU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |