C20H13F2NO2 — CID 131868108
[5-(3,4-difluorophenyl)-3-naphthalen-2-yl-1,2-oxazol-4-yl]methanol (PubChem CID 131868108) has the molecular formula C20H13F2NO2 and a molecular weight of 337.33 g/mol. Its IUPAC name is [5-(3,4-difluorophenyl)-3-naphthalen-2-yl-1,2-oxazol-4-yl]methanol.
| Compound Name | [5-(3,4-difluorophenyl)-3-naphthalen-2-yl-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131868108 |
| Molecular Formula | C20H13F2NO2 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [5-(3,4-difluorophenyl)-3-naphthalen-2-yl-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1c(-c2ccc3ccccc3c2)noc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H13F2NO2/c21-17-8-7-15(10-18(17)22)20-16(11-24)19(23-25-20)14-6-5-12-3-1-2-4-13(12)9-14/h1-10,24H,11H2 |
| InChIKey | BCKNDUFGXJNOFR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |