C16H9BrF3NO2 — CID 131867155
[3-(3-bromophenyl)-5-(2,4,5-trifluorophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131867155) has the molecular formula C16H9BrF3NO2 and a molecular weight of 384.15 g/mol. Its IUPAC name is [3-(3-bromophenyl)-5-(2,4,5-trifluorophenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [3-(3-bromophenyl)-5-(2,4,5-trifluorophenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131867155 |
| Molecular Formula | C16H9BrF3NO2 |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | [3-(3-bromophenyl)-5-(2,4,5-trifluorophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1c(-c2cccc(Br)c2)noc1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H9BrF3NO2/c17-9-3-1-2-8(4-9)15-11(7-22)16(23-21-15)10-5-13(19)14(20)6-12(10)18/h1-6,22H,7H2 |
| InChIKey | CMYRATXHUMOADH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|