C16H10BrF2NO2 — CID 131867217
[3-(2-bromophenyl)-5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131867217) has the molecular formula C16H10BrF2NO2 and a molecular weight of 366.16 g/mol. Its IUPAC name is [3-(2-bromophenyl)-5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [3-(2-bromophenyl)-5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131867217 |
| Molecular Formula | C16H10BrF2NO2 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | [3-(2-bromophenyl)-5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1c(-c2ccccc2Br)noc1-c1cccc(F)c1F |
| InChI | InChI=1S/C16H10BrF2NO2/c17-12-6-2-1-4-9(12)15-11(8-21)16(22-20-15)10-5-3-7-13(18)14(10)19/h1-7,21H,8H2 |
| InChIKey | FCAANIOLCGETDQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |