C20H12F3NO2 — CID 131868285
[3-naphthalen-1-yl-5-(2,3,4-trifluorophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131868285) has the molecular formula C20H12F3NO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is [3-naphthalen-1-yl-5-(2,3,4-trifluorophenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [3-naphthalen-1-yl-5-(2,3,4-trifluorophenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131868285 |
| Molecular Formula | C20H12F3NO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [3-naphthalen-1-yl-5-(2,3,4-trifluorophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1c(-c2cccc3ccccc23)noc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H12F3NO2/c21-16-9-8-14(17(22)18(16)23)20-15(10-25)19(24-26-20)13-7-3-5-11-4-1-2-6-12(11)13/h1-9,25H,10H2 |
| InChIKey | MYFGJCCLYPGRLK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|