C12H13F3N2O2 — CID 131871266
methyl 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 131871266) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is methyl 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 131871266 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | methyl 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)nc1[C@H]1CCCN1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-19-11(18)7-4-5-9(12(13,14)15)17-10(7)8-3-2-6-16-8/h4-5,8,16H,2-3,6H2,1H3/t8-/m1/s1 |
| InChIKey | HMDWXLUITIXMAM-MRVPVSSYSA-N |
| XLogP | 2.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |