C12H18O5 — CID 131872412
[(2S,3R,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate (PubChem CID 131872412) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is [(2S,3R,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate.
| Compound Name | [(2S,3R,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
|---|---|
| PubChem CID | 131872412 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [(2S,3R,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@@H]2OC(=O)C[C@@H]2[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C12H18O5/c1-6(13)15-11-9(12(2,3)4)7-5-8(14)16-10(7)17-11/h7,9-11H,5H2,1-4H3/t7-,9+,10+,11-/m1/s1 |
| InChIKey | KCBJSLRLYCHTAX-GRLWKWRFSA-N |
| XLogP | 1.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |