C12H20O5 — CID 18716737
3-(1,1-dimethoxy-2-methylbutan-2-yl)-4-methyloxolane-2,5-dione (PubChem CID 18716737) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-(1,1-dimethoxy-2-methylbutan-2-yl)-4-methyloxolane-2,5-dione.
| Compound Name | 3-(1,1-dimethoxy-2-methylbutan-2-yl)-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 18716737 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(1,1-dimethoxy-2-methylbutan-2-yl)-4-methyloxolane-2,5-dione |
| SMILES | CCC(C)(C(OC)OC)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C12H20O5/c1-6-12(3,11(15-4)16-5)8-7(2)9(13)17-10(8)14/h7-8,11H,6H2,1-5H3 |
| InChIKey | CWQKHTAINYPGSP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|