About CID 131873910
CID 131873910 (PubChem CID 131873910) has the molecular formula C6H9O4
and a molecular weight of 145.13 g/mol.
Molecular Properties
| Compound Name | CID 131873910 |
| PubChem CID | 131873910 |
| Molecular Formula | C6H9O4 |
| Molecular Weight | 145.13 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | — |
| SMILES | C[CH]CC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9O4/c1-2-3-4(5(7)8)6(9)10/h2,4H,3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | KOLWTKZAEMTOAW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 131873910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131873910?
The IUPAC name of CID 131873910 (CID 131873910) is not available.
What is the SMILES notation for CID 131873910?
The canonical SMILES for CID 131873910 is C[CH]CC(C(=O)O)C(=O)O.
What is the InChIKey of CID 131873910?
The InChIKey is KOLWTKZAEMTOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O4/c1-2-3-4(5(7)8)6(9)10/h2,4H,3H2,1H3,(H,7,8)(H,9,10).
What are the key properties of CID 131873910?
CID 131873910 has a molecular weight of 145.13 g/mol, XLogP of 0.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131873910 is sourced from PubChem (CID 131873910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).