C12H15FN2O5 — CID 131875354
3-fluoro-N-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzamide (PubChem CID 131875354) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-fluoro-N-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzamide.
| Compound Name | 3-fluoro-N-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzamide |
|---|---|
| PubChem CID | 131875354 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-fluoro-N-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzamide |
| SMILES | O=C(NN=C[C@H](O)[C@@H](O)[C@H](O)CO)c1cccc(F)c1 |
| InChI | InChI=1S/C12H15FN2O5/c13-8-3-1-2-7(4-8)12(20)15-14-5-9(17)11(19)10(18)6-16/h1-5,9-11,16-19H,6H2,(H,15,20)/t9-,10+,11+/m0/s1 |
| InChIKey | FMDIDSAIASZDJY-HBNTYKKESA-N |
| XLogP | -1.38 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|