C28H39F3N6O9 — CID 131876673
(2S)-N-(6-aminohexyl)-2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide;2,2,2-trifluoroacetic acid (PubChem CID 131876673) has the molecular formula C28H39F3N6O9 and a molecular weight of 660.65 g/mol. Its IUPAC name is (2S)-N-(6-aminohexyl)-2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-N-(6-aminohexyl)-2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 131876673 |
| Molecular Formula | C28H39F3N6O9 |
| Molecular Weight | 660.65 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | (2S)-N-(6-aminohexyl)-2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCCCCNC(=O)[C@H](CCCCNC(=O)CCN1C(=O)C=CC1=O)NC(=O)CCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H38N6O7.C2HF3O2/c27-14-4-1-2-5-16-29-26(39)19(30-21(34)13-18-32-24(37)10-11-25(32)38)7-3-6-15-28-20(33)12-17-31-22(35)8-9-23(31)36;3-2(4,5)1(6)7/h8-11,19H,1-7,12-18,27H2,(H,28,33)(H,29,39)(H,30,34);(H,6,7)/t19-;/m0./s1 |
| InChIKey | UMGLMHFEBLGXTI-FYZYNONXSA-N |
| XLogP | -0.34 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.65 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|