C24H30F6N6O10 — CID 172809084
2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 172809084) has the molecular formula C24H30F6N6O10 and a molecular weight of 676.52 g/mol. Its IUPAC name is 2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 172809084 |
| Molecular Formula | C24H30F6N6O10 |
| Molecular Weight | 676.52 g/mol |
| Exact Mass | 676.19 |
| IUPAC Name | 2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(C(=O)NCCCCN1C(=O)C=CC1=O)C(N)C(=O)NCCCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N6O6.2C2HF3O2/c21-17(19(31)23-9-1-3-11-25-13(27)5-6-14(25)28)18(22)20(32)24-10-2-4-12-26-15(29)7-8-16(26)30;2*3-2(4,5)1(6)7/h5-8,17-18H,1-4,9-12,21-22H2,(H,23,31)(H,24,32);2*(H,6,7) |
| InChIKey | RXMTWJAHXDKWJO-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 259.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.52 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|