C20H28N6O6 — CID 67459428
2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide (PubChem CID 67459428) has the molecular formula C20H28N6O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide.
| Compound Name | 2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide |
|---|---|
| PubChem CID | 67459428 |
| Molecular Formula | C20H28N6O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2,3-diamino-N,N'-bis[4-(2,5-dioxopyrrol-1-yl)butyl]butanediamide |
| SMILES | NC(C(=O)NCCCCN1C(=O)C=CC1=O)C(N)C(=O)NCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H28N6O6/c21-17(19(31)23-9-1-3-11-25-13(27)5-6-14(25)28)18(22)20(32)24-10-2-4-12-26-15(29)7-8-16(26)30/h5-8,17-18H,1-4,9-12,21-22H2,(H,23,31)(H,24,32) |
| InChIKey | VWQYMKRUXFASSR-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|