C24H28N6O12 — CID 156901229
4-[[4-(3-carboxypropylamino)-2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid (PubChem CID 156901229) has the molecular formula C24H28N6O12 and a molecular weight of 592.52 g/mol. Its IUPAC name is 4-[[4-(3-carboxypropylamino)-2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | 4-[[4-(3-carboxypropylamino)-2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 156901229 |
| Molecular Formula | C24H28N6O12 |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 4-[[4-(3-carboxypropylamino)-2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C(NC(=O)CN1C(=O)C=CC1=O)C(NC(=O)CN1C(=O)C=CC1=O)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C24H28N6O12/c31-13(11-29-15(33)5-6-16(29)34)27-21(23(41)25-9-1-3-19(37)38)22(24(42)26-10-2-4-20(39)40)28-14(32)12-30-17(35)7-8-18(30)36/h5-8,21-22H,1-4,9-12H2,(H,25,41)(H,26,42)(H,27,31)(H,28,32)(H,37,38)(H,39,40) |
| InChIKey | AVQAXKCPFDYSRF-UHFFFAOYSA-N |
| XLogP | -4.23 |
| TPSA | 265.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|