C12H16N2O2S2 — CID 131878560
methyl N'-methyl-N-[2-(4-methylphenyl)ethenylsulfonyl]carbamimidothioate (PubChem CID 131878560) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is methyl N'-methyl-N-[2-(4-methylphenyl)ethenylsulfonyl]carbamimidothioate.
| Compound Name | methyl N'-methyl-N-[2-(4-methylphenyl)ethenylsulfonyl]carbamimidothioate |
|---|---|
| PubChem CID | 131878560 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | methyl N'-methyl-N-[2-(4-methylphenyl)ethenylsulfonyl]carbamimidothioate |
| SMILES | C/N=C(/NS(=O)(=O)C=Cc1ccc(C)cc1)SC |
| InChI | InChI=1S/C12H16N2O2S2/c1-10-4-6-11(7-5-10)8-9-18(15,16)14-12(13-2)17-3/h4-9H,1-3H3,(H,13,14) |
| InChIKey | GTWYIXHVUQVTAK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|