About N'-(2-chlorophenyl)-N,N-diethylmethanimidamide
N'-(2-chlorophenyl)-N,N-diethylmethanimidamide (PubChem CID 131879491) has the molecular formula C11H15ClN2
and a molecular weight of 210.71 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N,N-diethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(2-chlorophenyl)-N,N-diethylmethanimidamide |
| PubChem CID | 131879491 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | N'-(2-chlorophenyl)-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/c1ccccc1Cl)CC |
| InChI | InChI=1S/C11H15ClN2/c1-3-14(4-2)9-13-11-8-6-5-7-10(11)12/h5-9H,3-4H2,1-2H3/b13-9+ |
| InChIKey | JOBRNBXQOZKMPR-UKTHLTGXSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-chlorophenyl)-N,N-diethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-chlorophenyl)-N,N-diethylmethanimidamide?
The IUPAC name of N'-(2-chlorophenyl)-N,N-diethylmethanimidamide (CID 131879491) is N'-(2-chlorophenyl)-N,N-diethylmethanimidamide.
What is the SMILES notation for N'-(2-chlorophenyl)-N,N-diethylmethanimidamide?
The canonical SMILES for N'-(2-chlorophenyl)-N,N-diethylmethanimidamide is CCN(/C=N/c1ccccc1Cl)CC.
What is the InChIKey of N'-(2-chlorophenyl)-N,N-diethylmethanimidamide?
The InChIKey is JOBRNBXQOZKMPR-UKTHLTGXSA-N. The full InChI is InChI=1S/C11H15ClN2/c1-3-14(4-2)9-13-11-8-6-5-7-10(11)12/h5-9H,3-4H2,1-2H3/b13-9+.
What are the key properties of N'-(2-chlorophenyl)-N,N-diethylmethanimidamide?
N'-(2-chlorophenyl)-N,N-diethylmethanimidamide has a molecular weight of 210.71 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-chlorophenyl)-N,N-diethylmethanimidamide is sourced from PubChem (CID 131879491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).