C11H15ClN2 — CID 131879491
N'-(2-chlorophenyl)-N,N-diethylmethanimidamide (PubChem CID 131879491) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N,N-diethylmethanimidamide.
| Compound Name | N'-(2-chlorophenyl)-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 131879491 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | N'-(2-chlorophenyl)-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/c1ccccc1Cl)CC |
| InChI | InChI=1S/C11H15ClN2/c1-3-14(4-2)9-13-11-8-6-5-7-10(11)12/h5-9H,3-4H2,1-2H3/b13-9+ |
| InChIKey | JOBRNBXQOZKMPR-UKTHLTGXSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|