C24H53NO8S3 — CID 131880713
4-hexadecyl-1,4-dimethylthiomorpholine-1,4-diium;methyl sulfate (PubChem CID 131880713) has the molecular formula C24H53NO8S3 and a molecular weight of 579.89 g/mol. Its IUPAC name is 4-hexadecyl-1,4-dimethylthiomorpholine-1,4-diium;methyl sulfate.
| Compound Name | 4-hexadecyl-1,4-dimethylthiomorpholine-1,4-diium;methyl sulfate |
|---|---|
| PubChem CID | 131880713 |
| Molecular Formula | C24H53NO8S3 |
| Molecular Weight | 579.89 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 4-hexadecyl-1,4-dimethylthiomorpholine-1,4-diium;methyl sulfate |
| SMILES | CCCCCCCCCCCCCCCC[N+]1(C)CC[S+](C)CC1.COS(=O)(=O)[O-].COS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H47NS.2CH4O4S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(2)19-21-24(3)22-20-23;2*1-5-6(2,3)4/h4-22H2,1-3H3;2*1H3,(H,2,3,4)/q+2;;/p-2 |
| InChIKey | NUYGLQOQCFULCU-UHFFFAOYSA-L |
| XLogP | 4.36 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|