C28H34N2O2 — CID 131881466
[(1R,2S,4R,6S,7S,10S,11R,14S)-6-cyano-7,11-dimethyl-5-phenyl-5-azapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate (PubChem CID 131881466) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(1R,2S,4R,6S,7S,10S,11R,14S)-6-cyano-7,11-dimethyl-5-phenyl-5-azapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate.
| Compound Name | [(1R,2S,4R,6S,7S,10S,11R,14S)-6-cyano-7,11-dimethyl-5-phenyl-5-azapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate |
|---|---|
| PubChem CID | 131881466 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | [(1R,2S,4R,6S,7S,10S,11R,14S)-6-cyano-7,11-dimethyl-5-phenyl-5-azapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3C[C@H]3N(c4ccccc4)[C@]32C#N)C1 |
| InChI | InChI=1S/C28H34N2O2/c1-18(31)32-21-11-13-26(2)19(15-21)9-10-22-23(26)12-14-27(3)24(22)16-25-28(27,17-29)30(25)20-7-5-4-6-8-20/h4-9,21-25H,10-16H2,1-3H3/t21-,22+,23-,24-,25+,26-,27-,28+,30?/m0/s1 |
| InChIKey | DJHLDAFCPAEUNN-AGMNXDBHSA-N |
| XLogP | 5.64 |
| TPSA | 53.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|