C30H38N2O2 — CID 99572254
[(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-phenylpyrazol-3-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 99572254) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-phenylpyrazol-3-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-phenylpyrazol-3-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 99572254 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | [(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-phenylpyrazol-3-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](c5ccnn5-c5ccccc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H38N2O2/c1-20(33)34-23-13-16-29(2)21(19-23)9-10-24-25-11-12-27(30(25,3)17-14-26(24)29)28-15-18-31-32(28)22-7-5-4-6-8-22/h4-9,15,18,23-27H,10-14,16-17,19H2,1-3H3/t23-,24+,25+,26+,27-,29+,30+/m1/s1 |
| InChIKey | JDTBPYJXTXCPSS-SCLWUFJISA-N |
| XLogP | 6.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|