C30H37NO2S — CID 500136
[10,13-dimethyl-17-(4-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 500136) has the molecular formula C30H37NO2S and a molecular weight of 475.70 g/mol. Its IUPAC name is [10,13-dimethyl-17-(4-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [10,13-dimethyl-17-(4-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 500136 |
| Molecular Formula | C30H37NO2S |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | [10,13-dimethyl-17-(4-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(c4nc(-c5ccccc5)cs4)CCC32)C1 |
| InChI | InChI=1S/C30H37NO2S/c1-19(32)33-22-13-15-29(2)21(17-22)9-10-23-24-11-12-26(30(24,3)16-14-25(23)29)28-31-27(18-34-28)20-7-5-4-6-8-20/h4-9,18,22-26H,10-17H2,1-3H3 |
| InChIKey | HUXBTPWQYLJEKJ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|