C25H35NO2S — CID 22210628
[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-methyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 22210628) has the molecular formula C25H35NO2S and a molecular weight of 413.63 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-methyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-methyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 22210628 |
| Molecular Formula | C25H35NO2S |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-methyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4ncc(C)s4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H35NO2S/c1-15-14-26-23(29-15)22-8-7-20-19-6-5-17-13-18(28-16(2)27)9-11-24(17,3)21(19)10-12-25(20,22)4/h5,14,18-22H,6-13H2,1-4H3/t18?,19-,20-,21-,22?,24-,25-/m0/s1 |
| InChIKey | LXWRVAWHVRXMQU-HGYRGGFJSA-N |
| XLogP | 6.43 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|