C32H39NO4S — CID 22210152
4-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 22210152) has the molecular formula C32H39NO4S and a molecular weight of 533.73 g/mol. Its IUPAC name is 4-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22210152 |
| Molecular Formula | C32H39NO4S |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 4-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(5-phenyl-1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | C[C@]12CCC(OC(=O)CCC(=O)O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3ncc(-c4ccccc4)s3)CC[C@@H]12 |
| InChI | InChI=1S/C32H39NO4S/c1-31-16-14-22(37-29(36)13-12-28(34)35)18-21(31)8-9-23-24-10-11-26(32(24,2)17-15-25(23)31)30-33-19-27(38-30)20-6-4-3-5-7-20/h3-8,19,22-26H,9-18H2,1-2H3,(H,34,35)/t22?,23-,24-,25-,26?,31-,32-/m0/s1 |
| InChIKey | YACQXVYAJXRDNB-LETMRCNQSA-N |
| XLogP | 7.63 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|