C31H43NO2 — CID 57305270
[(8R,9R,10R,13S,14S)-17-(cyclopropylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylpropanoate (PubChem CID 57305270) has the molecular formula C31H43NO2 and a molecular weight of 461.69 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-17-(cyclopropylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylpropanoate.
| Compound Name | [(8R,9R,10R,13S,14S)-17-(cyclopropylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 57305270 |
| Molecular Formula | C31H43NO2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-17-(cyclopropylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylpropanoate |
| SMILES | C[C@]12CCC(OC(=O)CCc3ccccc3)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(NC3CC3)CC[C@@H]12 |
| InChI | InChI=1S/C31H43NO2/c1-30-18-16-24(34-29(33)15-8-21-6-4-3-5-7-21)20-22(30)9-12-25-26-13-14-28(32-23-10-11-23)31(26,2)19-17-27(25)30/h3-7,9,23-28,32H,8,10-20H2,1-2H3/t24?,25-,26-,27+,28?,30-,31-/m0/s1 |
| InChIKey | XSMBQKLYECVYGS-YYWHVVPTSA-N |
| XLogP | 6.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|