C22H28N4O3 — CID 131884008
2-[5-amino-2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-(2-morpholin-4-ylethyl)-N-phenylacetamide (PubChem CID 131884008) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[5-amino-2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-(2-morpholin-4-ylethyl)-N-phenylacetamide.
| Compound Name | 2-[5-amino-2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-(2-morpholin-4-ylethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 131884008 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[5-amino-2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-(2-morpholin-4-ylethyl)-N-phenylacetamide |
| SMILES | CC(=NO)c1ccc(N)cc1CC(=O)N(CCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H28N4O3/c1-17(24-28)21-8-7-19(23)15-18(21)16-22(27)26(20-5-3-2-4-6-20)10-9-25-11-13-29-14-12-25/h2-8,15,28H,9-14,16,23H2,1H3 |
| InChIKey | XESIBZNAMLVMCY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|