C15H11Cl2N — CID 131886780
2-(2,4-dichlorophenyl)-5-methyl-1H-indole (PubChem CID 131886780) has the molecular formula C15H11Cl2N and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-1H-indole.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-1H-indole |
|---|---|
| PubChem CID | 131886780 |
| Molecular Formula | C15H11Cl2N |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-1H-indole |
| SMILES | Cc1ccc2[nH]c(-c3ccc(Cl)cc3Cl)cc2c1 |
| InChI | InChI=1S/C15H11Cl2N/c1-9-2-5-14-10(6-9)7-15(18-14)12-4-3-11(16)8-13(12)17/h2-8,18H,1H3 |
| InChIKey | QGBBRBVRNIKUOV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |