C18H20N2O3S — CID 131891485
[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]-[2-(1,3-thiazol-2-yl)piperidin-1-yl]methanone (PubChem CID 131891485) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is [5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]-[2-(1,3-thiazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | [5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]-[2-(1,3-thiazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 131891485 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]-[2-(1,3-thiazol-2-yl)piperidin-1-yl]methanone |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)N2CCCCC2c2nccs2)o1 |
| InChI | InChI=1S/C18H20N2O3S/c1-18(2,22)9-8-13-6-7-15(23-13)17(21)20-11-4-3-5-14(20)16-19-10-12-24-16/h6-7,10,12,14,22H,3-5,11H2,1-2H3 |
| InChIKey | LGWNXSPSPGRYCO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|