C15H19N3O3S — CID 131892364
2-ethyl-5-[3-(3-methylphenoxy)azetidin-1-yl]sulfonyl-1H-imidazole (PubChem CID 131892364) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-ethyl-5-[3-(3-methylphenoxy)azetidin-1-yl]sulfonyl-1H-imidazole.
| Compound Name | 2-ethyl-5-[3-(3-methylphenoxy)azetidin-1-yl]sulfonyl-1H-imidazole |
|---|---|
| PubChem CID | 131892364 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-ethyl-5-[3-(3-methylphenoxy)azetidin-1-yl]sulfonyl-1H-imidazole |
| SMILES | CCc1ncc(S(=O)(=O)N2CC(Oc3cccc(C)c3)C2)[nH]1 |
| InChI | InChI=1S/C15H19N3O3S/c1-3-14-16-8-15(17-14)22(19,20)18-9-13(10-18)21-12-6-4-5-11(2)7-12/h4-8,13H,3,9-10H2,1-2H3,(H,16,17) |
| InChIKey | MWWFSZUEOOFOHZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |